C36H39FO2Si — CID 134954050
triethyl-[(3E)-1-(4-fluorophenyl)-5-trityloxypenta-1,3-dien-2-yl]oxysilane (PubChem CID 134954050) has the molecular formula C36H39FO2Si and a molecular weight of 550.79 g/mol. Its IUPAC name is triethyl-[(3E)-1-(4-fluorophenyl)-5-trityloxypenta-1,3-dien-2-yl]oxysilane.
| Compound Name | triethyl-[(3E)-1-(4-fluorophenyl)-5-trityloxypenta-1,3-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 134954050 |
| Molecular Formula | C36H39FO2Si |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | triethyl-[(3E)-1-(4-fluorophenyl)-5-trityloxypenta-1,3-dien-2-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC(=Cc1ccc(F)cc1)/C=C/COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39FO2Si/c1-4-40(5-2,6-3)39-35(29-30-24-26-34(37)27-25-30)23-16-28-38-36(31-17-10-7-11-18-31,32-19-12-8-13-20-32)33-21-14-9-15-22-33/h7-27,29H,4-6,28H2,1-3H3/b23-16+,35-29? |
| InChIKey | IZHLFVISLGEHIG-MZKMZPNASA-N |
| XLogP | 9.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|