C42H49BF4O3Si — CID 135079992
tri(propan-2-yl)-[(3R,4S)-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxysilane (PubChem CID 135079992) has the molecular formula C42H49BF4O3Si and a molecular weight of 716.74 g/mol. Its IUPAC name is tri(propan-2-yl)-[(3R,4S)-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(3R,4S)-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxysilane |
|---|---|
| PubChem CID | 135079992 |
| Molecular Formula | C42H49BF4O3Si |
| Molecular Weight | 716.74 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | tri(propan-2-yl)-[(3R,4S)-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxysilane |
| SMILES | C=C[C@@H](B1OC(c2ccc(F)cc2)(c2ccc(F)cc2)C(c2ccc(F)cc2)(c2ccc(F)cc2)O1)[C@H](CCC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H49BF4O3Si/c1-9-11-40(48-51(28(3)4,29(5)6)30(7)8)39(10-2)43-49-41(31-12-20-35(44)21-13-31,32-14-22-36(45)23-15-32)42(50-43,33-16-24-37(46)25-17-33)34-18-26-38(47)27-19-34/h10,12-30,39-40H,2,9,11H2,1,3-8H3/t39-,40+/m1/s1 |
| InChIKey | GWNBHBVTYDZKAF-PVXQIPPMSA-N |
| XLogP | 11.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.74 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|