C23H17ClO7 — CID 70468705
2-chloro-3-methoxynaphthalene-1,4-dione;2,3-dimethoxynaphthalene-1,4-dione (PubChem CID 70468705) has the molecular formula C23H17ClO7 and a molecular weight of 440.84 g/mol. Its IUPAC name is 2-chloro-3-methoxynaphthalene-1,4-dione;2,3-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-chloro-3-methoxynaphthalene-1,4-dione;2,3-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 70468705 |
| Molecular Formula | C23H17ClO7 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-chloro-3-methoxynaphthalene-1,4-dione;2,3-dimethoxynaphthalene-1,4-dione |
| SMILES | COC1=C(Cl)C(=O)c2ccccc2C1=O.COC1=C(OC)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H10O4.C11H7ClO3/c1-15-11-9(13)7-5-3-4-6-8(7)10(14)12(11)16-2;1-15-11-8(12)9(13)6-4-2-3-5-7(6)10(11)14/h3-6H,1-2H3;2-5H,1H3 |
| InChIKey | UQWZPYJSXPBMQC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|