C26H18Cl2O4 — CID 139785662
2-chloro-3-[3-(3-chloro-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione (PubChem CID 139785662) has the molecular formula C26H18Cl2O4 and a molecular weight of 465.33 g/mol. Its IUPAC name is 2-chloro-3-[3-(3-chloro-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[3-(3-chloro-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139785662 |
| Molecular Formula | C26H18Cl2O4 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 2-chloro-3-[3-(3-chloro-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(C2CCCC(C3=C(Cl)C(=O)c4ccccc4C3=O)C2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H18Cl2O4/c27-21-19(23(29)15-8-1-3-10-17(15)25(21)31)13-6-5-7-14(12-13)20-22(28)26(32)18-11-4-2-9-16(18)24(20)30/h1-4,8-11,13-14H,5-7,12H2 |
| InChIKey | MZGHLNBXUXAYAT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|