C14H9ClO2 — CID 89138796
1-chloro-1,2-dihydroanthracene-9,10-dione (PubChem CID 89138796) has the molecular formula C14H9ClO2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 1-chloro-1,2-dihydroanthracene-9,10-dione.
| Compound Name | 1-chloro-1,2-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 89138796 |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1-chloro-1,2-dihydroanthracene-9,10-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)C(Cl)CC=C2 |
| InChI | InChI=1S/C14H9ClO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-6,11H,7H2 |
| InChIKey | SVRVVTKYUFYAJY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|