C22H22O4 — CID 142748984
2-cyclooctyl-1,4-dihydroxyanthracene-9,10-dione (PubChem CID 142748984) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-cyclooctyl-1,4-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-cyclooctyl-1,4-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 142748984 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-cyclooctyl-1,4-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(C3CCCCCCC3)cc(O)c21 |
| InChI | InChI=1S/C22H22O4/c23-17-12-16(13-8-4-2-1-3-5-9-13)22(26)19-18(17)20(24)14-10-6-7-11-15(14)21(19)25/h6-7,10-13,23,26H,1-5,8-9H2 |
| InChIKey | MREVZZFZXWJLFQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|