C30H28N2O — CID 134958403
(1S)-2'-cyclohexyl-5'-methyl-2,3-diphenylspiro[indene-1,4'-pyrazole]-3'-one (PubChem CID 134958403) has the molecular formula C30H28N2O and a molecular weight of 432.57 g/mol. Its IUPAC name is (1S)-2'-cyclohexyl-5'-methyl-2,3-diphenylspiro[indene-1,4'-pyrazole]-3'-one.
| Compound Name | (1S)-2'-cyclohexyl-5'-methyl-2,3-diphenylspiro[indene-1,4'-pyrazole]-3'-one |
|---|---|
| PubChem CID | 134958403 |
| Molecular Formula | C30H28N2O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (1S)-2'-cyclohexyl-5'-methyl-2,3-diphenylspiro[indene-1,4'-pyrazole]-3'-one |
| SMILES | CC1=NN(C2CCCCC2)C(=O)[C@@]12C(c1ccccc1)=C(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C30H28N2O/c1-21-30(29(33)32(31-21)24-17-9-4-10-18-24)26-20-12-11-19-25(26)27(22-13-5-2-6-14-22)28(30)23-15-7-3-8-16-23/h2-3,5-8,11-16,19-20,24H,4,9-10,17-18H2,1H3/t30-/m0/s1 |
| InChIKey | RWRXFTOEVZGXTK-PMERELPUSA-N |
| XLogP | 6.45 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|