C20H16N2O3 — CID 132558118
1,3'-dimethyl-2'-phenylspiro[1,3-diazinane-5,1'-indene]-2,4,6-trione (PubChem CID 132558118) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1,3'-dimethyl-2'-phenylspiro[1,3-diazinane-5,1'-indene]-2,4,6-trione.
| Compound Name | 1,3'-dimethyl-2'-phenylspiro[1,3-diazinane-5,1'-indene]-2,4,6-trione |
|---|---|
| PubChem CID | 132558118 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1,3'-dimethyl-2'-phenylspiro[1,3-diazinane-5,1'-indene]-2,4,6-trione |
| SMILES | CC1=C(c2ccccc2)C2(C(=O)NC(=O)N(C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C20H16N2O3/c1-12-14-10-6-7-11-15(14)20(16(12)13-8-4-3-5-9-13)17(23)21-19(25)22(2)18(20)24/h3-11H,1-2H3,(H,21,23,25) |
| InChIKey | DZQGOPHEIXZVCE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|