C21H18N2O5 — CID 71813808
(1S,5S,7S)-5-methoxy-1,2'-dimethyl-3-phenylspiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione (PubChem CID 71813808) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (1S,5S,7S)-5-methoxy-1,2'-dimethyl-3-phenylspiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione.
| Compound Name | (1S,5S,7S)-5-methoxy-1,2'-dimethyl-3-phenylspiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 71813808 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (1S,5S,7S)-5-methoxy-1,2'-dimethyl-3-phenylspiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione |
| SMILES | CO[C@@]12OC(c3ccccc3)=N[C@@]1(C)[C@]1(O2)C(=O)N(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O5/c1-19-20(15-12-8-7-11-14(15)17(24)23(2)18(20)25)28-21(19,26-3)27-16(22-19)13-9-5-4-6-10-13/h4-12H,1-3H3/t19-,20+,21+/m0/s1 |
| InChIKey | JQPXIZDNAVXKEX-PWRODBHTSA-N |
| XLogP | 2.06 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|