C18H20N2O5S — CID 53387951
(1S,5R,7S)-5-methoxy-2',3-dimethyl-1-(2-methylsulfanylethyl)spiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione (PubChem CID 53387951) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is (1S,5R,7S)-5-methoxy-2',3-dimethyl-1-(2-methylsulfanylethyl)spiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione.
| Compound Name | (1S,5R,7S)-5-methoxy-2',3-dimethyl-1-(2-methylsulfanylethyl)spiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 53387951 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (1S,5R,7S)-5-methoxy-2',3-dimethyl-1-(2-methylsulfanylethyl)spiro[4,6-dioxa-2-azabicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'-dione |
| SMILES | CO[C@]12OC(C)=N[C@@]1(CCSC)[C@]1(O2)C(=O)N(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H20N2O5S/c1-11-19-16(9-10-26-4)17(25-18(16,23-3)24-11)13-8-6-5-7-12(13)14(21)20(2)15(17)22/h5-8H,9-10H2,1-4H3/t16-,17+,18-/m0/s1 |
| InChIKey | HGPDIBMGNAARJV-KSZLIROESA-N |
| XLogP | 1.76 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|