C11H13NO2S2 — CID 53372017
2-(3-methylsulfanylpropyl)-1-oxo-1,2-benzothiazol-3-one (PubChem CID 53372017) has the molecular formula C11H13NO2S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(3-methylsulfanylpropyl)-1-oxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(3-methylsulfanylpropyl)-1-oxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 53372017 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-(3-methylsulfanylpropyl)-1-oxo-1,2-benzothiazol-3-one |
| SMILES | CSCCCN1C(=O)c2ccccc2S1=O |
| InChI | InChI=1S/C11H13NO2S2/c1-15-8-4-7-12-11(13)9-5-2-3-6-10(9)16(12)14/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | NGKQVRLSVNXPTC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|