About 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate
1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate (PubChem CID 144601887) has the molecular formula C15H13NO4S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate.
Molecular Properties
| Compound Name | 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate |
| PubChem CID | 144601887 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate |
| SMILES | O.O=C(Cc1ccccc1)N1C(=O)c2ccccc2S1=O |
| InChI | InChI=1S/C15H11NO3S.H2O/c17-14(10-11-6-2-1-3-7-11)16-15(18)12-8-4-5-9-13(12)20(16)19;/h1-9H,10H2;1H2 |
| InChIKey | QYAVXMVCZUSXMA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate?
The IUPAC name of 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate (CID 144601887) is 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate.
What is the SMILES notation for 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate?
The canonical SMILES for 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate is O.O=C(Cc1ccccc1)N1C(=O)c2ccccc2S1=O.
What is the InChIKey of 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate?
The InChIKey is QYAVXMVCZUSXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3S.H2O/c17-14(10-11-6-2-1-3-7-11)16-15(18)12-8-4-5-9-13(12)20(16)19;/h1-9H,10H2;1H2.
What are the key properties of 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate?
1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate has a molecular weight of 303.34 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-2-(2-phenylacetyl)-1,2-benzothiazol-3-one;hydrate is sourced from PubChem (CID 144601887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).