C22H19N3 — CID 628258
1,4,4-trimethyl-2,6-diphenylpyridine-3,5-dicarbonitrile (PubChem CID 628258) has the molecular formula C22H19N3 and a molecular weight of 325.42 g/mol. Its IUPAC name is 1,4,4-trimethyl-2,6-diphenylpyridine-3,5-dicarbonitrile.
| Compound Name | 1,4,4-trimethyl-2,6-diphenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 628258 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1,4,4-trimethyl-2,6-diphenylpyridine-3,5-dicarbonitrile |
| SMILES | CN1C(c2ccccc2)=C(C#N)C(C)(C)C(C#N)=C1c1ccccc1 |
| InChI | InChI=1S/C22H19N3/c1-22(2)18(14-23)20(16-10-6-4-7-11-16)25(3)21(19(22)15-24)17-12-8-5-9-13-17/h4-13H,1-3H3 |
| InChIKey | DAJLZSAGPPAXFO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |