C24H21N3 — CID 628061
2,4-diphenyl-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile (PubChem CID 628061) has the molecular formula C24H21N3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2,4-diphenyl-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile.
| Compound Name | 2,4-diphenyl-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 628061 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2,4-diphenyl-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarbonitrile |
| SMILES | N#CC1=C(c2ccccc2)NC(c2ccccc2)=C(C#N)C12CCCCC2 |
| InChI | InChI=1S/C24H21N3/c25-16-20-22(18-10-4-1-5-11-18)27-23(19-12-6-2-7-13-19)21(17-26)24(20)14-8-3-9-15-24/h1-2,4-7,10-13,27H,3,8-9,14-15H2 |
| InChIKey | KBOYUTWTNSGEOF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |