C18H13N3O — CID 15830924
2-methyl-3,3-diphenyl-1,2-oxazole-4,5-dicarbonitrile (PubChem CID 15830924) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-methyl-3,3-diphenyl-1,2-oxazole-4,5-dicarbonitrile.
| Compound Name | 2-methyl-3,3-diphenyl-1,2-oxazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 15830924 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-methyl-3,3-diphenyl-1,2-oxazole-4,5-dicarbonitrile |
| SMILES | CN1OC(C#N)=C(C#N)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H13N3O/c1-21-18(14-8-4-2-5-9-14,15-10-6-3-7-11-15)16(12-19)17(13-20)22-21/h2-11H,1H3 |
| InChIKey | GTZCFQLPPRSZTB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |