C14H12N4S — CID 4090682
2-amino-4-methyl-4-phenyl-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile (PubChem CID 4090682) has the molecular formula C14H12N4S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-amino-4-methyl-4-phenyl-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-methyl-4-phenyl-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 4090682 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-amino-4-methyl-4-phenyl-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile |
| SMILES | CC1(c2ccccc2)C(C#N)=C(N)NC(S)=C1C#N |
| InChI | InChI=1S/C14H12N4S/c1-14(9-5-3-2-4-6-9)10(7-15)12(17)18-13(19)11(14)8-16/h2-6,18-19H,17H2,1H3 |
| InChIKey | HEQWRPRANYPIEG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|