C15H14N4O3 — CID 98085178
(3R,4R,5R)-8-amino-3-hydroxy-4-methyl-1,6-dioxo-3-phenyl-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile (PubChem CID 98085178) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is (3R,4R,5R)-8-amino-3-hydroxy-4-methyl-1,6-dioxo-3-phenyl-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile.
| Compound Name | (3R,4R,5R)-8-amino-3-hydroxy-4-methyl-1,6-dioxo-3-phenyl-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile |
|---|---|
| PubChem CID | 98085178 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (3R,4R,5R)-8-amino-3-hydroxy-4-methyl-1,6-dioxo-3-phenyl-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile |
| SMILES | C[C@@H]1[C@@]2(C(=O)NC(N)=C2C#N)C(=O)N[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C15H14N4O3/c1-8-14(10(7-16)11(17)18-12(14)20)13(21)19-15(8,22)9-5-3-2-4-6-9/h2-6,8,22H,17H2,1H3,(H,18,20)(H,19,21)/t8-,14-,15-/m1/s1 |
| InChIKey | IAWKKRFIJOXXHV-KBOAJJQZSA-N |
| XLogP | -0.59 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|