C19H16BrN3O3 — CID 7375155
(3R,4S,5R,6R)-4-(3-bromophenyl)-5-cyano-6-hydroxy-2-oxo-6-phenylpiperidine-3-carboxamide (PubChem CID 7375155) has the molecular formula C19H16BrN3O3 and a molecular weight of 414.26 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-(3-bromophenyl)-5-cyano-6-hydroxy-2-oxo-6-phenylpiperidine-3-carboxamide.
| Compound Name | (3R,4S,5R,6R)-4-(3-bromophenyl)-5-cyano-6-hydroxy-2-oxo-6-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 7375155 |
| Molecular Formula | C19H16BrN3O3 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (3R,4S,5R,6R)-4-(3-bromophenyl)-5-cyano-6-hydroxy-2-oxo-6-phenylpiperidine-3-carboxamide |
| SMILES | N#C[C@H]1[C@H](c2cccc(Br)c2)[C@H](C(N)=O)C(=O)N[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C19H16BrN3O3/c20-13-8-4-5-11(9-13)15-14(10-21)19(26,12-6-2-1-3-7-12)23-18(25)16(15)17(22)24/h1-9,14-16,26H,(H2,22,24)(H,23,25)/t14-,15-,16+,19-/m0/s1 |
| InChIKey | XPGRJOAXSVRQOE-GGXPGOJBSA-N |
| XLogP | 1.75 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|