C13H12BrN3O4 — CID 115946835
3-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanamide (PubChem CID 115946835) has the molecular formula C13H12BrN3O4 and a molecular weight of 354.16 g/mol. Its IUPAC name is 3-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanamide.
| Compound Name | 3-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanamide |
|---|---|
| PubChem CID | 115946835 |
| Molecular Formula | C13H12BrN3O4 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanamide |
| SMILES | NC(=O)CCN1C(=O)NC(=O)C(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C13H12BrN3O4/c14-8-3-1-2-7(6-8)10-11(19)16-13(21)17(12(10)20)5-4-9(15)18/h1-3,6,10H,4-5H2,(H2,15,18)(H,16,19,21) |
| InChIKey | IZOQXRRFYFKVLT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|