C13H12BrN3O2 — CID 112640033
3-(3-bromophenyl)-1,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine-2,4-dione (PubChem CID 112640033) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine-2,4-dione.
| Compound Name | 3-(3-bromophenyl)-1,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112640033 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 3-(3-bromophenyl)-1,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine-2,4-dione |
| SMILES | O=C1NC2=NCCCN2C(=O)C1c1cccc(Br)c1 |
| InChI | InChI=1S/C13H12BrN3O2/c14-9-4-1-3-8(7-9)10-11(18)16-13-15-5-2-6-17(13)12(10)19/h1,3-4,7,10H,2,5-6H2,(H,15,16,18) |
| InChIKey | IKUQXBIJDAGSAN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|