C13H11BrN2O5 — CID 115945836
methyl 2-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate (PubChem CID 115945836) has the molecular formula C13H11BrN2O5 and a molecular weight of 355.14 g/mol. Its IUPAC name is methyl 2-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate.
| Compound Name | methyl 2-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate |
|---|---|
| PubChem CID | 115945836 |
| Molecular Formula | C13H11BrN2O5 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | methyl 2-[5-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)NC(=O)C(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C13H11BrN2O5/c1-21-9(17)6-16-12(19)10(11(18)15-13(16)20)7-3-2-4-8(14)5-7/h2-5,10H,6H2,1H3,(H,15,18,20) |
| InChIKey | CMDSTSPKVLIPKA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|