C10H12N4O3 — CID 102191912
8-amino-3-hydroxy-3,4-dimethyl-1,6-dioxo-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile (PubChem CID 102191912) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 8-amino-3-hydroxy-3,4-dimethyl-1,6-dioxo-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile.
| Compound Name | 8-amino-3-hydroxy-3,4-dimethyl-1,6-dioxo-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile |
|---|---|
| PubChem CID | 102191912 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 8-amino-3-hydroxy-3,4-dimethyl-1,6-dioxo-2,7-diazaspiro[4.4]non-8-ene-9-carbonitrile |
| SMILES | CC1C(C)(O)NC(=O)C12C(=O)NC(N)=C2C#N |
| InChI | InChI=1S/C10H12N4O3/c1-4-9(2,17)14-8(16)10(4)5(3-11)6(12)13-7(10)15/h4,17H,12H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | DUCOJBIDVDVXQG-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|