C17H14N4O2 — CID 98349352
(1R,3S,5S,8R)-5-hydroxy-8-methyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile (PubChem CID 98349352) has the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. Its IUPAC name is (1R,3S,5S,8R)-5-hydroxy-8-methyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile.
| Compound Name | (1R,3S,5S,8R)-5-hydroxy-8-methyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
|---|---|
| PubChem CID | 98349352 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (1R,3S,5S,8R)-5-hydroxy-8-methyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
| SMILES | C[C@H]1[C@@]2(O)C[C@@H](c3ccccc3)C(C#N)(C#N)[C@]1(C#N)C(=O)N2 |
| InChI | InChI=1S/C17H14N4O2/c1-11-16(10-20)14(22)21-17(11,23)7-13(15(16,8-18)9-19)12-5-3-2-4-6-12/h2-6,11,13,23H,7H2,1H3,(H,21,22)/t11-,13+,16+,17+/m1/s1 |
| InChIKey | CDQRUXMHJJPZRU-DTJGQCLQSA-N |
| XLogP | 1.17 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |