C19H18N4O2 — CID 671886
(1R,4S,7S,8R)-1-hydroxy-3-oxo-8-phenyl-7-propyl-2-azabicyclo[2.2.2]octane-4,5,5-tricarbonitrile (PubChem CID 671886) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (1R,4S,7S,8R)-1-hydroxy-3-oxo-8-phenyl-7-propyl-2-azabicyclo[2.2.2]octane-4,5,5-tricarbonitrile.
| Compound Name | (1R,4S,7S,8R)-1-hydroxy-3-oxo-8-phenyl-7-propyl-2-azabicyclo[2.2.2]octane-4,5,5-tricarbonitrile |
|---|---|
| PubChem CID | 671886 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1R,4S,7S,8R)-1-hydroxy-3-oxo-8-phenyl-7-propyl-2-azabicyclo[2.2.2]octane-4,5,5-tricarbonitrile |
| SMILES | CCC[C@H]1[C@H](c2ccccc2)[C@]2(C#N)C(=O)N[C@@]1(O)CC2(C#N)C#N |
| InChI | InChI=1S/C19H18N4O2/c1-2-6-14-15(13-7-4-3-5-8-13)18(12-22)16(24)23-19(14,25)9-17(18,10-20)11-21/h3-5,7-8,14-15,25H,2,6,9H2,1H3,(H,23,24)/t14-,15-,18+,19+/m0/s1 |
| InChIKey | BJHORRYYTAYWKY-ILRDRHFLSA-N |
| XLogP | 1.95 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |