C16H11BrN4O2 — CID 98342007
(1R,3R,4R,5R)-4-bromo-5-hydroxy-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile (PubChem CID 98342007) has the molecular formula C16H11BrN4O2 and a molecular weight of 371.19 g/mol. Its IUPAC name is (1R,3R,4R,5R)-4-bromo-5-hydroxy-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile.
| Compound Name | (1R,3R,4R,5R)-4-bromo-5-hydroxy-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
|---|---|
| PubChem CID | 98342007 |
| Molecular Formula | C16H11BrN4O2 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | (1R,3R,4R,5R)-4-bromo-5-hydroxy-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](c2ccccc2)[C@@H](Br)[C@]2(O)C[C@@]1(C#N)C(=O)N2 |
| InChI | InChI=1S/C16H11BrN4O2/c17-12-11(10-4-2-1-3-5-10)15(8-19,9-20)14(7-18)6-16(12,23)21-13(14)22/h1-5,11-12,23H,6H2,(H,21,22)/t11-,12+,14+,16+/m0/s1 |
| InChIKey | RZIYULXBHNHLCK-KLZCAUPSSA-N |
| XLogP | 1.30 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|