C16H15N3O — CID 139822658
2-(2-aminophenyl)-4-methyl-4-phenyl-1H-imidazol-5-one (PubChem CID 139822658) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(2-aminophenyl)-4-methyl-4-phenyl-1H-imidazol-5-one.
| Compound Name | 2-(2-aminophenyl)-4-methyl-4-phenyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 139822658 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(2-aminophenyl)-4-methyl-4-phenyl-1H-imidazol-5-one |
| SMILES | CC1(c2ccccc2)N=C(c2ccccc2N)NC1=O |
| InChI | InChI=1S/C16H15N3O/c1-16(11-7-3-2-4-8-11)15(20)18-14(19-16)12-9-5-6-10-13(12)17/h2-10H,17H2,1H3,(H,18,19,20) |
| InChIKey | LRWYAOZYSVNBQG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|