C15H14N6OS — CID 135881863
(5R)-8-(2-aminophenyl)-3-thiophen-2-yl-1,2,6,7,9-pentazaspiro[4.5]deca-2,7-dien-10-one (PubChem CID 135881863) has the molecular formula C15H14N6OS and a molecular weight of 326.38 g/mol. Its IUPAC name is (5R)-8-(2-aminophenyl)-3-thiophen-2-yl-1,2,6,7,9-pentazaspiro[4.5]deca-2,7-dien-10-one.
| Compound Name | (5R)-8-(2-aminophenyl)-3-thiophen-2-yl-1,2,6,7,9-pentazaspiro[4.5]deca-2,7-dien-10-one |
|---|---|
| PubChem CID | 135881863 |
| Molecular Formula | C15H14N6OS |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (5R)-8-(2-aminophenyl)-3-thiophen-2-yl-1,2,6,7,9-pentazaspiro[4.5]deca-2,7-dien-10-one |
| SMILES | Nc1ccccc1C1=NN[C@]2(CC(c3cccs3)=NN2)C(=O)N1 |
| InChI | InChI=1S/C15H14N6OS/c16-10-5-2-1-4-9(10)13-17-14(22)15(21-19-13)8-11(18-20-15)12-6-3-7-23-12/h1-7,20-21H,8,16H2,(H,17,19,22)/t15-/m1/s1 |
| InChIKey | LKEULAWYUYCAMN-OAHLLOKOSA-N |
| XLogP | 0.81 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|