C22H16FN3O2S — CID 7677451
1-[[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione (PubChem CID 7677451) has the molecular formula C22H16FN3O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-[[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 7677451 |
| Molecular Formula | C22H16FN3O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-[[(3S)-3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2N=C(c3cccs3)C[C@H]2c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H16FN3O2S/c23-15-9-7-14(8-10-15)19-12-17(20-6-3-11-29-20)24-26(19)13-25-18-5-2-1-4-16(18)21(27)22(25)28/h1-11,19H,12-13H2/t19-/m0/s1 |
| InChIKey | KLFLNWGIOGXNAR-IBGZPJMESA-N |
| XLogP | 4.23 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|