C24H16Br3N3O2 — CID 99651698
1-[[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]methyl]-5-bromoindole-2,3-dione (PubChem CID 99651698) has the molecular formula C24H16Br3N3O2 and a molecular weight of 618.12 g/mol. Its IUPAC name is 1-[[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]methyl]-5-bromoindole-2,3-dione.
| Compound Name | 1-[[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]methyl]-5-bromoindole-2,3-dione |
|---|---|
| PubChem CID | 99651698 |
| Molecular Formula | C24H16Br3N3O2 |
| Molecular Weight | 618.12 g/mol |
| Exact Mass | 614.88 |
| IUPAC Name | 1-[[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]methyl]-5-bromoindole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2N=C(c3ccc(Br)cc3)C[C@@H]2c2ccc(Br)cc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C24H16Br3N3O2/c25-16-5-1-14(2-6-16)20-12-22(15-3-7-17(26)8-4-15)30(28-20)13-29-21-10-9-18(27)11-19(21)23(31)24(29)32/h1-11,22H,12-13H2/t22-/m1/s1 |
| InChIKey | YVJWRFAHMQEOLA-JOCHJYFZSA-N |
| XLogP | 6.31 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.12 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|