C24H17BrClN3O2 — CID 41038477
1-[[(3S)-5-(4-bromophenyl)-3-(2-chlorophenyl)-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione (PubChem CID 41038477) has the molecular formula C24H17BrClN3O2 and a molecular weight of 494.78 g/mol. Its IUPAC name is 1-[[(3S)-5-(4-bromophenyl)-3-(2-chlorophenyl)-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[(3S)-5-(4-bromophenyl)-3-(2-chlorophenyl)-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 41038477 |
| Molecular Formula | C24H17BrClN3O2 |
| Molecular Weight | 494.78 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 1-[[(3S)-5-(4-bromophenyl)-3-(2-chlorophenyl)-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2N=C(c3ccc(Br)cc3)C[C@H]2c2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C24H17BrClN3O2/c25-16-11-9-15(10-12-16)20-13-22(17-5-1-3-7-19(17)26)29(27-20)14-28-21-8-4-2-6-18(21)23(30)24(28)31/h1-12,22H,13-14H2/t22-/m0/s1 |
| InChIKey | BPVMAHDFDQQQGF-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.78 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|