C23H19N3O3S — CID 7678137
1-[[(3R)-3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione (PubChem CID 7678137) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-[[(3R)-3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[(3R)-3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 7678137 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 1-[[(3R)-3-(4-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
| SMILES | COc1ccc([C@H]2CC(c3cccs3)=NN2CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H19N3O3S/c1-29-16-10-8-15(9-11-16)20-13-18(21-7-4-12-30-21)24-26(20)14-25-19-6-3-2-5-17(19)22(27)23(25)28/h2-12,20H,13-14H2,1H3/t20-/m1/s1 |
| InChIKey | RYBBDSNHMKOIQD-HXUWFJFHSA-N |
| XLogP | 4.09 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|