C25H20BrN3O3 — CID 99803066
6-bromo-1-[[(3S)-5-(4-methoxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione (PubChem CID 99803066) has the molecular formula C25H20BrN3O3 and a molecular weight of 490.36 g/mol. Its IUPAC name is 6-bromo-1-[[(3S)-5-(4-methoxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione.
| Compound Name | 6-bromo-1-[[(3S)-5-(4-methoxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 99803066 |
| Molecular Formula | C25H20BrN3O3 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 6-bromo-1-[[(3S)-5-(4-methoxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]methyl]indole-2,3-dione |
| SMILES | COc1ccc(C2=NN(CN3C(=O)C(=O)c4ccc(Br)cc43)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H20BrN3O3/c1-32-19-10-7-16(8-11-19)21-14-22(17-5-3-2-4-6-17)29(27-21)15-28-23-13-18(26)9-12-20(23)24(30)25(28)31/h2-13,22H,14-15H2,1H3/t22-/m0/s1 |
| InChIKey | QNDDVNLVWAUPTK-QFIPXVFZSA-N |
| XLogP | 4.80 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|