C16H15N3O3 — CID 163117059
N-hydroxy-4-[(4R)-4-methyl-5-oxo-4-phenyl-1H-imidazol-2-yl]benzeneamine oxide (PubChem CID 163117059) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-hydroxy-4-[(4R)-4-methyl-5-oxo-4-phenyl-1H-imidazol-2-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[(4R)-4-methyl-5-oxo-4-phenyl-1H-imidazol-2-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163117059 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-hydroxy-4-[(4R)-4-methyl-5-oxo-4-phenyl-1H-imidazol-2-yl]benzeneamine oxide |
| SMILES | C[C@]1(c2ccccc2)N=C(c2ccc([NH+]([O-])O)cc2)NC1=O |
| InChI | InChI=1S/C16H15N3O3/c1-16(12-5-3-2-4-6-12)15(20)17-14(18-16)11-7-9-13(10-8-11)19(21)22/h2-10,19,21H,1H3,(H,17,18,20)/t16-/m1/s1 |
| InChIKey | AEILFCWQFPGBQO-MRXNPFEDSA-N |
| XLogP | 0.88 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|