C18H15Cl2N3O2 — CID 98209179
N-[(4R)-4-(dichloromethyl)-2-(4-methylphenyl)-5-oxo-1H-imidazol-4-yl]benzamide (PubChem CID 98209179) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is N-[(4R)-4-(dichloromethyl)-2-(4-methylphenyl)-5-oxo-1H-imidazol-4-yl]benzamide.
| Compound Name | N-[(4R)-4-(dichloromethyl)-2-(4-methylphenyl)-5-oxo-1H-imidazol-4-yl]benzamide |
|---|---|
| PubChem CID | 98209179 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[(4R)-4-(dichloromethyl)-2-(4-methylphenyl)-5-oxo-1H-imidazol-4-yl]benzamide |
| SMILES | Cc1ccc(C2=N[C@@](NC(=O)c3ccccc3)(C(Cl)Cl)C(=O)N2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-11-7-9-12(10-8-11)14-21-17(25)18(22-14,16(19)20)23-15(24)13-5-3-2-4-6-13/h2-10,16H,1H3,(H,23,24)(H,21,22,25)/t18-/m1/s1 |
| InChIKey | PEWRANPDVUEPOW-GOSISDBHSA-N |
| XLogP | 2.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|