C17H12Cl2FN3O2 — CID 98310543
N-[(4R)-4-(dichloromethyl)-5-oxo-2-phenyl-1H-imidazol-4-yl]-4-fluorobenzamide (PubChem CID 98310543) has the molecular formula C17H12Cl2FN3O2 and a molecular weight of 380.21 g/mol. Its IUPAC name is N-[(4R)-4-(dichloromethyl)-5-oxo-2-phenyl-1H-imidazol-4-yl]-4-fluorobenzamide.
| Compound Name | N-[(4R)-4-(dichloromethyl)-5-oxo-2-phenyl-1H-imidazol-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 98310543 |
| Molecular Formula | C17H12Cl2FN3O2 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[(4R)-4-(dichloromethyl)-5-oxo-2-phenyl-1H-imidazol-4-yl]-4-fluorobenzamide |
| SMILES | O=C(N[C@@]1(C(Cl)Cl)N=C(c2ccccc2)NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12Cl2FN3O2/c18-15(19)17(23-14(24)11-6-8-12(20)9-7-11)16(25)21-13(22-17)10-4-2-1-3-5-10/h1-9,15H,(H,23,24)(H,21,22,25)/t17-/m1/s1 |
| InChIKey | VDFKKWAGMHAICI-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|