C22H17FN4O2 — CID 142743863
4-fluoro-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzohydrazide (PubChem CID 142743863) has the molecular formula C22H17FN4O2 and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-fluoro-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzohydrazide.
| Compound Name | 4-fluoro-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 142743863 |
| Molecular Formula | C22H17FN4O2 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-fluoro-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzohydrazide |
| SMILES | O=C(NNC1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O2/c23-16-12-10-15(11-13-16)21(28)27-26-20-22(29)24-18-9-5-4-8-17(18)19(25-20)14-6-2-1-3-7-14/h1-13,20,26H,(H,24,29)(H,27,28) |
| InChIKey | MGFKAYMCUNBDSO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|