C27H28FN5O — CID 142553162
3-[[(1E,3Z)-1,4-diamino-4-(4-fluorophenyl)buta-1,3-dienyl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;ethane (PubChem CID 142553162) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[[(1E,3Z)-1,4-diamino-4-(4-fluorophenyl)buta-1,3-dienyl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;ethane.
| Compound Name | 3-[[(1E,3Z)-1,4-diamino-4-(4-fluorophenyl)buta-1,3-dienyl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;ethane |
|---|---|
| PubChem CID | 142553162 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 3-[[(1E,3Z)-1,4-diamino-4-(4-fluorophenyl)buta-1,3-dienyl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;ethane |
| SMILES | CC.N/C(=C\C=C(/N)NC1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FN5O.C2H6/c26-18-12-10-16(11-13-18)20(27)14-15-22(28)30-24-25(32)29-21-9-5-4-8-19(21)23(31-24)17-6-2-1-3-7-17;1-2/h1-15,24,30H,27-28H2,(H,29,32);1-2H3/b20-14-,22-15+; |
| InChIKey | AKHONDISQBVEGF-GRBGYLQUSA-N |
| XLogP | 4.36 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|