C12H11Cl2N3O2S — CID 98168463
N-[(4R)-4-(dichloromethyl)-2-methylsulfanyl-5-oxo-1H-imidazol-4-yl]benzamide (PubChem CID 98168463) has the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.21 g/mol. Its IUPAC name is N-[(4R)-4-(dichloromethyl)-2-methylsulfanyl-5-oxo-1H-imidazol-4-yl]benzamide.
| Compound Name | N-[(4R)-4-(dichloromethyl)-2-methylsulfanyl-5-oxo-1H-imidazol-4-yl]benzamide |
|---|---|
| PubChem CID | 98168463 |
| Molecular Formula | C12H11Cl2N3O2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[(4R)-4-(dichloromethyl)-2-methylsulfanyl-5-oxo-1H-imidazol-4-yl]benzamide |
| SMILES | CSC1=N[C@@](NC(=O)c2ccccc2)(C(Cl)Cl)C(=O)N1 |
| InChI | InChI=1S/C12H11Cl2N3O2S/c1-20-11-15-10(19)12(17-11,9(13)14)16-8(18)7-5-3-2-4-6-7/h2-6,9H,1H3,(H,16,18)(H,15,17,19)/t12-/m0/s1 |
| InChIKey | BQABDLYFXSYVFA-LBPRGKRZSA-N |
| XLogP | 1.77 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|