C12H12Cl2N4O3S — CID 98209154
N-[(4R)-5-amino-4-(dichloromethyl)-2-methylsulfonylimidazol-4-yl]benzamide (PubChem CID 98209154) has the molecular formula C12H12Cl2N4O3S and a molecular weight of 363.23 g/mol. Its IUPAC name is N-[(4R)-5-amino-4-(dichloromethyl)-2-methylsulfonylimidazol-4-yl]benzamide.
| Compound Name | N-[(4R)-5-amino-4-(dichloromethyl)-2-methylsulfonylimidazol-4-yl]benzamide |
|---|---|
| PubChem CID | 98209154 |
| Molecular Formula | C12H12Cl2N4O3S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | N-[(4R)-5-amino-4-(dichloromethyl)-2-methylsulfonylimidazol-4-yl]benzamide |
| SMILES | CS(=O)(=O)C1=N[C@@](NC(=O)c2ccccc2)(C(Cl)Cl)C(N)=N1 |
| InChI | InChI=1S/C12H12Cl2N4O3S/c1-22(20,21)11-16-10(15)12(18-11,9(13)14)17-8(19)7-5-3-2-4-6-7/h2-6,9H,1H3,(H,17,19)(H2,15,16,18)/t12-/m0/s1 |
| InChIKey | ZIFPQBCMWYEGQM-LBPRGKRZSA-N |
| XLogP | 0.69 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|