C15H18Cl2N4O — CID 98198526
N-[(4S)-5-amino-4-(dichloromethyl)-2-phenylimidazol-4-yl]-2,2-dimethylpropanamide (PubChem CID 98198526) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is N-[(4S)-5-amino-4-(dichloromethyl)-2-phenylimidazol-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(4S)-5-amino-4-(dichloromethyl)-2-phenylimidazol-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 98198526 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[(4S)-5-amino-4-(dichloromethyl)-2-phenylimidazol-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N[C@]1(C(Cl)Cl)N=C(c2ccccc2)N=C1N |
| InChI | InChI=1S/C15H18Cl2N4O/c1-14(2,3)13(22)21-15(11(16)17)12(18)19-10(20-15)9-7-5-4-6-8-9/h4-8,11H,1-3H3,(H,21,22)(H2,18,19,20)/t15-/m0/s1 |
| InChIKey | KOJJBHWESPTEBW-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|