C18H19NO3 — CID 84820712
2-(2,2-dimethylpropanoylamino)-3-phenylbenzoic acid (PubChem CID 84820712) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-3-phenylbenzoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-3-phenylbenzoic acid |
|---|---|
| PubChem CID | 84820712 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-3-phenylbenzoic acid |
| SMILES | CC(C)(C)C(=O)Nc1c(C(=O)O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-18(2,3)17(22)19-15-13(12-8-5-4-6-9-12)10-7-11-14(15)16(20)21/h4-11H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | AWWCSEWSPKXERY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |