C10H10N3O3- — CID 163644161
5-methyl-2-oxido-5-phenyltriazinane-4,6-dione (PubChem CID 163644161) has the molecular formula C10H10N3O3- and a molecular weight of 220.21 g/mol. Its IUPAC name is 5-methyl-2-oxido-5-phenyltriazinane-4,6-dione.
| Compound Name | 5-methyl-2-oxido-5-phenyltriazinane-4,6-dione |
|---|---|
| PubChem CID | 163644161 |
| Molecular Formula | C10H10N3O3- |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 5-methyl-2-oxido-5-phenyltriazinane-4,6-dione |
| SMILES | CC1(c2ccccc2)C(=O)NN([O-])NC1=O |
| InChI | InChI=1S/C10H10N3O3/c1-10(7-5-3-2-4-6-7)8(14)11-13(16)12-9(10)15/h2-6H,1H3,(H,11,14)(H,12,15)/q-1 |
| InChIKey | NOWIZUZWRWJGMO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|