C16H30N4 — CID 91607627
ethane;5-methyl-5-phenylimidazole-2,4-diamine (PubChem CID 91607627) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is ethane;5-methyl-5-phenylimidazole-2,4-diamine.
| Compound Name | ethane;5-methyl-5-phenylimidazole-2,4-diamine |
|---|---|
| PubChem CID | 91607627 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | ethane;5-methyl-5-phenylimidazole-2,4-diamine |
| SMILES | CC.CC.CC.CC1(c2ccccc2)N=C(N)N=C1N |
| InChI | InChI=1S/C10H12N4.3C2H6/c1-10(7-5-3-2-4-6-7)8(11)13-9(12)14-10;3*1-2/h2-6H,1H3,(H4,11,12,13,14);3*1-2H3 |
| InChIKey | HWZDZBZIQJQJPT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |