C30H20O2 — CID 164682129
(1R)-5'-methyl-2,3-diphenyl-1,2'-spirobi[indene]-1',3'-dione (PubChem CID 164682129) has the molecular formula C30H20O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (1R)-5'-methyl-2,3-diphenyl-1,2'-spirobi[indene]-1',3'-dione.
| Compound Name | (1R)-5'-methyl-2,3-diphenyl-1,2'-spirobi[indene]-1',3'-dione |
|---|---|
| PubChem CID | 164682129 |
| Molecular Formula | C30H20O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (1R)-5'-methyl-2,3-diphenyl-1,2'-spirobi[indene]-1',3'-dione |
| SMILES | Cc1ccc2c(c1)C(=O)[C@@]1(C2=O)C(c2ccccc2)=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H20O2/c1-19-16-17-22-24(18-19)29(32)30(28(22)31)25-15-9-8-14-23(25)26(20-10-4-2-5-11-20)27(30)21-12-6-3-7-13-21/h2-18H,1H3/t30-/m1/s1 |
| InChIKey | FTXFLVHKRUDGSP-SSEXGKCCSA-N |
| XLogP | 6.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|