C13H12NO2S2+ — CID 134892101
(4,9-dioxo-3a,9a-dihydrobenzo[f][1,3]benzodithiol-2-ylidene)-dimethylazanium (PubChem CID 134892101) has the molecular formula C13H12NO2S2+ and a molecular weight of 278.38 g/mol. Its IUPAC name is (4,9-dioxo-3a,9a-dihydrobenzo[f][1,3]benzodithiol-2-ylidene)-dimethylazanium.
| Compound Name | (4,9-dioxo-3a,9a-dihydrobenzo[f][1,3]benzodithiol-2-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 134892101 |
| Molecular Formula | C13H12NO2S2+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (4,9-dioxo-3a,9a-dihydrobenzo[f][1,3]benzodithiol-2-ylidene)-dimethylazanium |
| SMILES | C[N+](C)=C1SC2C(=O)c3ccccc3C(=O)C2S1 |
| InChI | InChI=1S/C13H12NO2S2/c1-14(2)13-17-11-9(15)7-5-3-4-6-8(7)10(16)12(11)18-13/h3-6,11-12H,1-2H3/q+1 |
| InChIKey | WRXCKVSYGILRKE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|