C11H9NO3 — CID 7113706
2-(hydroxymethyliminomethyl)indene-1,3-dione (PubChem CID 7113706) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-(hydroxymethyliminomethyl)indene-1,3-dione.
| Compound Name | 2-(hydroxymethyliminomethyl)indene-1,3-dione |
|---|---|
| PubChem CID | 7113706 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-(hydroxymethyliminomethyl)indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C=NCO |
| InChI | InChI=1S/C11H9NO3/c13-6-12-5-9-10(14)7-3-1-2-4-8(7)11(9)15/h1-5,9,13H,6H2 |
| InChIKey | WSVXANCEAONKEW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|