C19H14O3 — CID 91359379
3-(3-phenylprop-1-enyl)naphthalene-1,2,4-trione (PubChem CID 91359379) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-(3-phenylprop-1-enyl)naphthalene-1,2,4-trione.
| Compound Name | 3-(3-phenylprop-1-enyl)naphthalene-1,2,4-trione |
|---|---|
| PubChem CID | 91359379 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-(3-phenylprop-1-enyl)naphthalene-1,2,4-trione |
| SMILES | O=C1C(=O)C(C=CCc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H14O3/c20-17-14-10-4-5-11-15(14)18(21)19(22)16(17)12-6-9-13-7-2-1-3-8-13/h1-8,10-12,16H,9H2 |
| InChIKey | YZKOQSFZWYAYLN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|