C11H8O3 — CID 170000010
2-(1,3-dioxoinden-2-yl)acetaldehyde (PubChem CID 170000010) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-(1,3-dioxoinden-2-yl)acetaldehyde.
| Compound Name | 2-(1,3-dioxoinden-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 170000010 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-(1,3-dioxoinden-2-yl)acetaldehyde |
| SMILES | O=CCC1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O3/c12-6-5-9-10(13)7-3-1-2-4-8(7)11(9)14/h1-4,6,9H,5H2 |
| InChIKey | HVHZURQJVJEUDP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|