About isoindol-2-ium-1,3-dione
isoindol-2-ium-1,3-dione (PubChem CID 143913338) has the molecular formula C8H6NO2+
and a molecular weight of 148.14 g/mol. Its IUPAC name is isoindol-2-ium-1,3-dione.
Molecular Properties
| Compound Name | isoindol-2-ium-1,3-dione |
| PubChem CID | 143913338 |
| Molecular Formula | C8H6NO2+ |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | isoindol-2-ium-1,3-dione |
| SMILES | O=C1[NH2+]C(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11)/p+1 |
| InChIKey | XKJCHHZQLQNZHY-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 50.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze isoindol-2-ium-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindol-2-ium-1,3-dione?
The IUPAC name of isoindol-2-ium-1,3-dione (CID 143913338) is isoindol-2-ium-1,3-dione.
What is the SMILES notation for isoindol-2-ium-1,3-dione?
The canonical SMILES for isoindol-2-ium-1,3-dione is O=C1[NH2+]C(=O)c2ccccc21.
What is the InChIKey of isoindol-2-ium-1,3-dione?
The InChIKey is XKJCHHZQLQNZHY-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11)/p+1.
What are the key properties of isoindol-2-ium-1,3-dione?
isoindol-2-ium-1,3-dione has a molecular weight of 148.14 g/mol, XLogP of -0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoindol-2-ium-1,3-dione is sourced from PubChem (CID 143913338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).