About mercury(1+);5-sulfinatonaphthalene-1,4-dione
mercury(1+);5-sulfinatonaphthalene-1,4-dione (PubChem CID 175318135) has the molecular formula C10H5HgO4S
and a molecular weight of 421.80 g/mol. Its IUPAC name is mercury(1+);5-sulfinatonaphthalene-1,4-dione.
Molecular Properties
| Compound Name | mercury(1+);5-sulfinatonaphthalene-1,4-dione |
| PubChem CID | 175318135 |
| Molecular Formula | C10H5HgO4S |
| Molecular Weight | 421.80 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | mercury(1+);5-sulfinatonaphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)c2c1cccc2[S-](=O)=O.[Hg+] |
| InChI | InChI=1S/C10H5O4S.Hg/c11-7-4-5-8(12)10-6(7)2-1-3-9(10)15(13)14;/h1-5H;/q-1;+1 |
| InChIKey | OPKVQRKHMVLMBK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze mercury(1+);5-sulfinatonaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(1+);5-sulfinatonaphthalene-1,4-dione?
The IUPAC name of mercury(1+);5-sulfinatonaphthalene-1,4-dione (CID 175318135) is mercury(1+);5-sulfinatonaphthalene-1,4-dione.
What is the SMILES notation for mercury(1+);5-sulfinatonaphthalene-1,4-dione?
The canonical SMILES for mercury(1+);5-sulfinatonaphthalene-1,4-dione is O=C1C=CC(=O)c2c1cccc2[S-](=O)=O.[Hg+].
What is the InChIKey of mercury(1+);5-sulfinatonaphthalene-1,4-dione?
The InChIKey is OPKVQRKHMVLMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5O4S.Hg/c11-7-4-5-8(12)10-6(7)2-1-3-9(10)15(13)14;/h1-5H;/q-1;+1.
What are the key properties of mercury(1+);5-sulfinatonaphthalene-1,4-dione?
mercury(1+);5-sulfinatonaphthalene-1,4-dione has a molecular weight of 421.80 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(1+);5-sulfinatonaphthalene-1,4-dione is sourced from PubChem (CID 175318135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).